C16H15NOS2 — CID 24502669
N-cyclopentylthieno[3,2-b][1]benzothiole-2-carboxamide (PubChem CID 24502669) has the molecular formula C16H15NOS2 and a molecular weight of 301.44 g/mol. Its IUPAC name is N-cyclopentylthieno[3,2-b][1]benzothiole-2-carboxamide.
| Compound Name | N-cyclopentylthieno[3,2-b][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 24502669 |
| Molecular Formula | C16H15NOS2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-cyclopentylthieno[3,2-b][1]benzothiole-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc2sc3ccccc3c2s1 |
| InChI | InChI=1S/C16H15NOS2/c18-16(17-10-5-1-2-6-10)14-9-13-15(20-14)11-7-3-4-8-12(11)19-13/h3-4,7-10H,1-2,5-6H2,(H,17,18) |
| InChIKey | KPPORGAQYAXXER-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |