C17H15ClN2OS — CID 6622571
4-chloro-N-cyclopentylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 6622571) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is 4-chloro-N-cyclopentylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-cyclopentylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 6622571 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-chloro-N-cyclopentylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc2c(Cl)nc3ccccc3c2s1 |
| InChI | InChI=1S/C17H15ClN2OS/c18-16-12-9-14(17(21)19-10-5-1-2-6-10)22-15(12)11-7-3-4-8-13(11)20-16/h3-4,7-10H,1-2,5-6H2,(H,19,21) |
| InChIKey | HUDVFCDOZYNJGU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|