C19H21N3O2S — CID 46326113
N-cyclooctyl-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide (PubChem CID 46326113) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-cyclooctyl-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide.
| Compound Name | N-cyclooctyl-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 46326113 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-cyclooctyl-4-oxo-[1,3]thiazino[3,2-a]benzimidazole-2-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)c1cc(=O)n2c(nc3ccccc32)s1 |
| InChI | InChI=1S/C19H21N3O2S/c23-17-12-16(18(24)20-13-8-4-2-1-3-5-9-13)25-19-21-14-10-6-7-11-15(14)22(17)19/h6-7,10-13H,1-5,8-9H2,(H,20,24) |
| InChIKey | MARYZZGKEVIZSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |