C21H23ClN2OS — CID 92666311
4-chloro-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-8-methylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 92666311) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-8-methylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-8-methylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 92666311 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-chloro-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-8-methylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | Cc1ccc2nc(Cl)c3cc(C(=O)N[C@@H]4CCC[C@@H](C)[C@H]4C)sc3c2c1 |
| InChI | InChI=1S/C21H23ClN2OS/c1-11-7-8-17-14(9-11)19-15(20(22)23-17)10-18(26-19)21(25)24-16-6-4-5-12(2)13(16)3/h7-10,12-13,16H,4-6H2,1-3H3,(H,24,25)/t12-,13-,16-/m1/s1 |
| InChIKey | SKTWPSLIDRWTQS-XJKCOSOUSA-N |
| XLogP | 5.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|