C13H19NOS — CID 4072672
N-(2,3-dimethylcyclohexyl)thiophene-2-carboxamide (PubChem CID 4072672) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)thiophene-2-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4072672 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)thiophene-2-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2cccs2)C1C |
| InChI | InChI=1S/C13H19NOS/c1-9-5-3-6-11(10(9)2)14-13(15)12-7-4-8-16-12/h4,7-11H,3,5-6H2,1-2H3,(H,14,15) |
| InChIKey | VUCRNQVFAQHUML-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |