C20H30N4O2S2 — CID 11927456
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[1-(thiophene-2-carbonyl)piperidine-4-carbonyl]amino]thiourea (PubChem CID 11927456) has the molecular formula C20H30N4O2S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[1-(thiophene-2-carbonyl)piperidine-4-carbonyl]amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[1-(thiophene-2-carbonyl)piperidine-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 11927456 |
| Molecular Formula | C20H30N4O2S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[[1-(thiophene-2-carbonyl)piperidine-4-carbonyl]amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H30N4O2S2/c1-13-5-3-6-16(14(13)2)21-20(27)23-22-18(25)15-8-10-24(11-9-15)19(26)17-7-4-12-28-17/h4,7,12-16H,3,5-6,8-11H2,1-2H3,(H,22,25)(H2,21,23,27)/t13-,14-,16+/m1/s1 |
| InChIKey | IPVBBTQBNJRLSH-FMKPAKJESA-N |
| XLogP | 2.92 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|