C15H19F2NO — CID 124811505
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,6-difluorobenzamide (PubChem CID 124811505) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,6-difluorobenzamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 124811505 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2,6-difluorobenzamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2NO/c1-9-5-3-8-13(10(9)2)18-15(19)14-11(16)6-4-7-12(14)17/h4,6-7,9-10,13H,3,5,8H2,1-2H3,(H,18,19)/t9-,10+,13-/m1/s1 |
| InChIKey | BGNURWWVENGVGO-GBIKHYSHSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |