C13H19NO2 — CID 40617423
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]furan-2-carboxamide (PubChem CID 40617423) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]furan-2-carboxamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 40617423 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]furan-2-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H19NO2/c1-9-5-3-6-11(10(9)2)14-13(15)12-7-4-8-16-12/h4,7-11H,3,5-6H2,1-2H3,(H,14,15)/t9-,10-,11-/m1/s1 |
| InChIKey | RZGCUTGKLOKALL-GMTAPVOTSA-N |
| XLogP | 2.83 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |