C11H15NO3 — CID 27126578
N-[(1R,2R)-2-hydroxycyclohexyl]furan-2-carboxamide (PubChem CID 27126578) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]furan-2-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27126578 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccco1 |
| InChI | InChI=1S/C11H15NO3/c13-9-5-2-1-4-8(9)12-11(14)10-6-3-7-15-10/h3,6-9,13H,1-2,4-5H2,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | OGKWHCOSQJHOIA-RKDXNWHRSA-N |
| XLogP | 1.31 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |