C11H14N2O2 — CID 155850992
N-(7-azabicyclo[2.2.1]heptan-2-yl)furan-2-carboxamide (PubChem CID 155850992) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)furan-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 155850992 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccco1 |
| InChI | InChI=1S/C11H14N2O2/c14-11(10-2-1-5-15-10)13-9-6-7-3-4-8(9)12-7/h1-2,5,7-9,12H,3-4,6H2,(H,13,14) |
| InChIKey | KTHKQBSSCBUBGV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |