C16H16FN3O2 — CID 18534899
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide (PubChem CID 18534899) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 18534899 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccc(-c2cccnc2F)o1 |
| InChI | InChI=1S/C16H16FN3O2/c17-15-10(2-1-7-18-15)13-5-6-14(22-13)16(21)20-12-8-9-3-4-11(12)19-9/h1-2,5-7,9,11-12,19H,3-4,8H2,(H,20,21) |
| InChIKey | NDDOFQJLHHDQDA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|