C18H20FIN2O2 — CID 161354262
N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-5-(4-fluorophenyl)furan-2-carboxamide;iodomethane (PubChem CID 161354262) has the molecular formula C18H20FIN2O2 and a molecular weight of 442.27 g/mol. Its IUPAC name is N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-5-(4-fluorophenyl)furan-2-carboxamide;iodomethane.
| Compound Name | N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-5-(4-fluorophenyl)furan-2-carboxamide;iodomethane |
|---|---|
| PubChem CID | 161354262 |
| Molecular Formula | C18H20FIN2O2 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N-[(2R)-7-azabicyclo[2.2.1]heptan-2-yl]-5-(4-fluorophenyl)furan-2-carboxamide;iodomethane |
| SMILES | CI.O=C(N[C@@H]1CC2CCC1N2)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H17FN2O2.CH3I/c18-11-3-1-10(2-4-11)15-7-8-16(22-15)17(21)20-14-9-12-5-6-13(14)19-12;1-2/h1-4,7-8,12-14,19H,5-6,9H2,(H,20,21);1H3/t12?,13?,14-;/m1./s1 |
| InChIKey | VOIDVAPGZSXQGS-YLIRPONSSA-N |
| XLogP | 3.76 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|