C16H16ClN3O2 — CID 18535263
N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(5-chloro-3-pyridinyl)furan-2-carboxamide (PubChem CID 18535263) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(5-chloro-3-pyridinyl)furan-2-carboxamide.
| Compound Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(5-chloro-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 18535263 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-(7-azabicyclo[2.2.1]heptan-2-yl)-5-(5-chloro-3-pyridinyl)furan-2-carboxamide |
| SMILES | O=C(NC1CC2CCC1N2)c1ccc(-c2cncc(Cl)c2)o1 |
| InChI | InChI=1S/C16H16ClN3O2/c17-10-5-9(7-18-8-10)14-3-4-15(22-14)16(21)20-13-6-11-1-2-12(13)19-11/h3-5,7-8,11-13,19H,1-2,6H2,(H,20,21) |
| InChIKey | REYJZDYRPVPKTJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |