C17H18FN3O2 — CID 21350196
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide (PubChem CID 21350196) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 21350196 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(2-fluoro-3-pyridinyl)furan-2-carboxamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1ccc(-c2cccnc2F)o1 |
| InChI | InChI=1S/C17H18FN3O2/c18-16-12(2-1-7-19-16)14-3-4-15(23-14)17(22)20-13-10-21-8-5-11(13)6-9-21/h1-4,7,11,13H,5-6,8-10H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | PDOBLSDCVBKXNE-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|