C17H18N2O2 — CID 59113576
N-[(3R,4R)-1-azabicyclo[2.2.1]heptan-3-yl]-5-phenylfuran-2-carboxamide (PubChem CID 59113576) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(3R,4R)-1-azabicyclo[2.2.1]heptan-3-yl]-5-phenylfuran-2-carboxamide.
| Compound Name | N-[(3R,4R)-1-azabicyclo[2.2.1]heptan-3-yl]-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 59113576 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[(3R,4R)-1-azabicyclo[2.2.1]heptan-3-yl]-5-phenylfuran-2-carboxamide |
| SMILES | O=C(N[C@H]1CN2CC[C@@H]1C2)c1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(18-14-11-19-9-8-13(14)10-19)16-7-6-15(21-16)12-4-2-1-3-5-12/h1-7,13-14H,8-11H2,(H,18,20)/t13-,14+/m1/s1 |
| InChIKey | SKNYHBUOGZHYHW-KGLIPLIRSA-N |
| XLogP | 2.38 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |