C24H25N3O2 — CID 18180723
5-(4-anilinophenyl)-N-(1-azabicyclo[2.2.2]octan-3-yl)furan-2-carboxamide (PubChem CID 18180723) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-(4-anilinophenyl)-N-(1-azabicyclo[2.2.2]octan-3-yl)furan-2-carboxamide.
| Compound Name | 5-(4-anilinophenyl)-N-(1-azabicyclo[2.2.2]octan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 18180723 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-(4-anilinophenyl)-N-(1-azabicyclo[2.2.2]octan-3-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(-c2ccc(Nc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C24H25N3O2/c28-24(26-21-16-27-14-12-17(21)13-15-27)23-11-10-22(29-23)18-6-8-20(9-7-18)25-19-4-2-1-3-5-19/h1-11,17,21,25H,12-16H2,(H,26,28) |
| InChIKey | SNVPPLMUMSTPLS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |