C23H23F3N2O6 — CID 70024793
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide;but-2-enedioic acid (PubChem CID 70024793) has the molecular formula C23H23F3N2O6 and a molecular weight of 480.44 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide;but-2-enedioic acid.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 70024793 |
| Molecular Formula | C23H23F3N2O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-[3-(trifluoromethyl)phenyl]furan-2-carboxamide;but-2-enedioic acid |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1ccc(-c2cccc(C(F)(F)F)c2)o1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H19F3N2O2.C4H4O4/c20-19(21,22)14-3-1-2-13(10-14)16-4-5-17(26-16)18(25)23-15-11-24-8-6-12(15)7-9-24;5-3(6)1-2-4(7)8/h1-5,10,12,15H,6-9,11H2,(H,23,25);1-2H,(H,5,6)(H,7,8)/t15-;/m0./s1 |
| InChIKey | LCPHZZPWFFCXKK-RSAXXLAASA-N |
| XLogP | 3.50 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|