C23H23F3N2O6 — CID 158852236
(E)-but-2-enedioic acid;(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone (PubChem CID 158852236) has the molecular formula C23H23F3N2O6 and a molecular weight of 480.44 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone.
| Compound Name | (E)-but-2-enedioic acid;(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 158852236 |
| Molecular Formula | C23H23F3N2O6 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (E)-but-2-enedioic acid;(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone |
| SMILES | CN1C2CCC1CN(C(=O)c1ccc(-c3cccc(C(F)(F)F)c3)o1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H19F3N2O2.C4H4O4/c1-23-14-5-6-15(23)11-24(10-14)18(25)17-8-7-16(26-17)12-3-2-4-13(9-12)19(20,21)22;5-3(6)1-2-4(7)8/h2-4,7-9,14-15H,5-6,10-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IZPJTAAODILAMV-WLHGVMLRSA-N |
| XLogP | 3.60 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|