C24H21F3N2O3 — CID 34568931
(3R)-N-phenyl-1-[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]piperidine-3-carboxamide (PubChem CID 34568931) has the molecular formula C24H21F3N2O3 and a molecular weight of 442.44 g/mol. Its IUPAC name is (3R)-N-phenyl-1-[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-phenyl-1-[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 34568931 |
| Molecular Formula | C24H21F3N2O3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (3R)-N-phenyl-1-[5-[3-(trifluoromethyl)phenyl]furan-2-carbonyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CCCN(C(=O)c2ccc(-c3cccc(C(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C24H21F3N2O3/c25-24(26,27)18-8-4-6-16(14-18)20-11-12-21(32-20)23(31)29-13-5-7-17(15-29)22(30)28-19-9-2-1-3-10-19/h1-4,6,8-12,14,17H,5,7,13,15H2,(H,28,30)/t17-/m1/s1 |
| InChIKey | QEPUGEQXCPUPIX-QGZVFWFLSA-N |
| XLogP | 5.46 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |