C23H23F3N4O2 — CID 55486154
[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone (PubChem CID 55486154) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is [2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone.
| Compound Name | [2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 55486154 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2cccc(C(F)(F)F)c2)o1)N1CCCC1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H23F3N4O2/c24-23(25,26)16-7-4-6-15(14-16)18-10-11-19(32-18)22(31)29-13-5-8-17(29)21-28-27-20-9-2-1-3-12-30(20)21/h4,6-7,10-11,14,17H,1-3,5,8-9,12-13H2 |
| InChIKey | ZFFACGCCPKPKNB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |