C18H23N5O — CID 119874115
(3-aminophenyl)-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 119874115) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (3-aminophenyl)-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3-aminophenyl)-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119874115 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (3-aminophenyl)-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | Nc1cccc(C(=O)N2CCCCC2c2nnc3n2CCCC3)c1 |
| InChI | InChI=1S/C18H23N5O/c19-14-7-5-6-13(12-14)18(24)22-10-3-1-8-15(22)17-21-20-16-9-2-4-11-23(16)17/h5-7,12,15H,1-4,8-11,19H2 |
| InChIKey | CEGZFQQJWIKMLR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|