C18H20ClFN4O — CID 99818328
(2-chloro-4-fluorophenyl)-[(2S)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone (PubChem CID 99818328) has the molecular formula C18H20ClFN4O and a molecular weight of 362.84 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[(2S)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[(2S)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 99818328 |
| Molecular Formula | C18H20ClFN4O |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[(2S)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCCC[C@H]1c1nnc2n1CCCC2 |
| InChI | InChI=1S/C18H20ClFN4O/c19-14-11-12(20)7-8-13(14)18(25)23-9-3-1-5-15(23)17-22-21-16-6-2-4-10-24(16)17/h7-8,11,15H,1-6,9-10H2/t15-/m0/s1 |
| InChIKey | KGRMFECQYBJSKJ-HNNXBMFYSA-N |
| XLogP | 3.77 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |