C17H19FN4O — CID 124847822
[(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanone (PubChem CID 124847822) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is [(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanone.
| Compound Name | [(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 124847822 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | [(2S)-2-(4-fluorophenyl)pyrrolidin-1-yl]-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanone |
| SMILES | O=C(c1nnc2n1CCCC2)N1CCC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN4O/c18-13-8-6-12(7-9-13)14-4-3-11-21(14)17(23)16-20-19-15-5-1-2-10-22(15)16/h6-9,14H,1-5,10-11H2/t14-/m0/s1 |
| InChIKey | LOOOILBXXJRJHR-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |