C20H25FN4O — CID 42462335
(1-cycloheptyltriazol-4-yl)-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 42462335) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is (1-cycloheptyltriazol-4-yl)-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (1-cycloheptyltriazol-4-yl)-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42462335 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1-cycloheptyltriazol-4-yl)-[(2R)-2-(4-fluorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cn(C2CCCCCC2)nn1)N1CCC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O/c21-16-11-9-15(10-12-16)19-8-5-13-24(19)20(26)18-14-25(23-22-18)17-6-3-1-2-4-7-17/h9-12,14,17,19H,1-8,13H2/t19-/m1/s1 |
| InChIKey | ZXTHMQFZOIWGCV-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |