C22H30N4O2 — CID 42346388
(1-cyclohexyltriazol-4-yl)-[(2S)-2-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methanone (PubChem CID 42346388) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is (1-cyclohexyltriazol-4-yl)-[(2S)-2-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methanone.
| Compound Name | (1-cyclohexyltriazol-4-yl)-[(2S)-2-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42346388 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (1-cyclohexyltriazol-4-yl)-[(2S)-2-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cn(C2CCCCC2)nn1)N1CCCC[C@H]1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C22H30N4O2/c27-20-13-10-17(11-14-20)9-12-18-6-4-5-15-25(18)22(28)21-16-26(24-23-21)19-7-2-1-3-8-19/h10-11,13-14,16,18-19,27H,1-9,12,15H2/t18-/m0/s1 |
| InChIKey | QDSXUWCTIPQZQQ-SFHVURJKSA-N |
| XLogP | 4.12 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |