C18H24N4OS — CID 56818508
(3-ethylthiophen-2-yl)-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 56818508) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is (3-ethylthiophen-2-yl)-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-ethylthiophen-2-yl)-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 56818508 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (3-ethylthiophen-2-yl)-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | CCc1ccsc1C(=O)N1CCCC1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C18H24N4OS/c1-2-13-9-12-24-16(13)18(23)21-11-6-7-14(21)17-20-19-15-8-4-3-5-10-22(15)17/h9,12,14H,2-8,10-11H2,1H3 |
| InChIKey | QWLRBQSWGHWTSM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |