C20H23N5OS2 — CID 51938558
1-[(2R)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone (PubChem CID 51938558) has the molecular formula C20H23N5OS2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-[(2R)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-[(2R)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 51938558 |
| Molecular Formula | C20H23N5OS2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[(2R)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)pyrrolidin-1-yl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)ethanone |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)N1CCC[C@@H]1c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C20H23N5OS2/c26-18(11-15-13-28-20(21-15)14-7-10-27-12-14)24-9-4-5-16(24)19-23-22-17-6-2-1-3-8-25(17)19/h7,10,12-13,16H,1-6,8-9,11H2/t16-/m1/s1 |
| InChIKey | BCFHSIDYOCFKCI-MRXNPFEDSA-N |
| XLogP | 4.10 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |