C17H19FN4O — CID 18181920
N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(2-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide (PubChem CID 18181920) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(2-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(2-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18181920 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-5-(2-fluoro-3-pyridinyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(-c2cccnc2F)[nH]1 |
| InChI | InChI=1S/C17H19FN4O/c18-16-12(2-1-7-19-16)13-3-4-14(20-13)17(23)21-15-10-22-8-5-11(15)6-9-22/h1-4,7,11,15,20H,5-6,8-10H2,(H,21,23) |
| InChIKey | HGGDZEZJHUBAOP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|