C19H19Cl2N3O2S — CID 4566683
N-(1-azabicyclo[2.2.2]octan-3-ylcarbamothioyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 4566683) has the molecular formula C19H19Cl2N3O2S and a molecular weight of 424.35 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-ylcarbamothioyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-ylcarbamothioyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4566683 |
| Molecular Formula | C19H19Cl2N3O2S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-ylcarbamothioyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)NC1CN2CCC1CC2)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H19Cl2N3O2S/c20-13-3-1-2-12(17(13)21)15-4-5-16(26-15)18(25)23-19(27)22-14-10-24-8-6-11(14)7-9-24/h1-5,11,14H,6-10H2,(H2,22,23,25,27) |
| InChIKey | VHWMOTIDWNLPLA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|