C24H21Cl3N4O3S — CID 17317714
N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 17317714) has the molecular formula C24H21Cl3N4O3S and a molecular weight of 551.88 g/mol. Its IUPAC name is N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17317714 |
| Molecular Formula | C24H21Cl3N4O3S |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3ccc(-c4cccc(Cl)c4Cl)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C24H21Cl3N4O3S/c1-14(32)30-9-11-31(12-10-30)19-6-5-15(13-18(19)26)28-24(35)29-23(33)21-8-7-20(34-21)16-3-2-4-17(25)22(16)27/h2-8,13H,9-12H2,1H3,(H2,28,29,33,35) |
| InChIKey | KWFXTPBTBBGFLQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|