C20H14Cl2N2O3S — CID 1395394
N-[(4-acetylphenyl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 1395394) has the molecular formula C20H14Cl2N2O3S and a molecular weight of 433.32 g/mol. Its IUPAC name is N-[(4-acetylphenyl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(4-acetylphenyl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1395394 |
| Molecular Formula | C20H14Cl2N2O3S |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | N-[(4-acetylphenyl)carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=S)NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C20H14Cl2N2O3S/c1-11(25)12-5-7-13(8-6-12)23-20(28)24-19(26)17-10-9-16(27-17)14-3-2-4-15(21)18(14)22/h2-10H,1H3,(H2,23,24,26,28) |
| InChIKey | GICVGMGMKQNLFT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|