C18H10Cl4N2O2S — CID 2065633
5-(2,3-dichlorophenyl)-N-[(2,5-dichlorophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 2065633) has the molecular formula C18H10Cl4N2O2S and a molecular weight of 460.17 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-N-[(2,5-dichlorophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,3-dichlorophenyl)-N-[(2,5-dichlorophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2065633 |
| Molecular Formula | C18H10Cl4N2O2S |
| Molecular Weight | 460.17 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-N-[(2,5-dichlorophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(Cl)ccc1Cl)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H10Cl4N2O2S/c19-9-4-5-11(20)13(8-9)23-18(27)24-17(25)15-7-6-14(26-15)10-2-1-3-12(21)16(10)22/h1-8H,(H2,23,24,25,27) |
| InChIKey | KCWLWCWWYZTUND-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.17 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|