C24H14Cl3NO3 — CID 2066709
N-(2-benzoyl-4-chlorophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 2066709) has the molecular formula C24H14Cl3NO3 and a molecular weight of 470.74 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2066709 |
| Molecular Formula | C24H14Cl3NO3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)c1ccccc1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C24H14Cl3NO3/c25-15-9-10-19(17(13-15)23(29)14-5-2-1-3-6-14)28-24(30)21-12-11-20(31-21)16-7-4-8-18(26)22(16)27/h1-13H,(H,28,30) |
| InChIKey | PZAJRBSWHPYLMR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |