C19H13Cl2NO4 — CID 3641679
methyl 2-[[5-(2,3-dichlorophenyl)furan-2-carbonyl]amino]benzoate (PubChem CID 3641679) has the molecular formula C19H13Cl2NO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is methyl 2-[[5-(2,3-dichlorophenyl)furan-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(2,3-dichlorophenyl)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3641679 |
| Molecular Formula | C19H13Cl2NO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | methyl 2-[[5-(2,3-dichlorophenyl)furan-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C19H13Cl2NO4/c1-25-19(24)11-5-2-3-8-14(11)22-18(23)16-10-9-15(26-16)12-6-4-7-13(20)17(12)21/h2-10H,1H3,(H,22,23) |
| InChIKey | QGMSDFORCGRHAK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |