C19H13Cl2NO5 — CID 2814404
methyl 2-[[5-(3,5-dichlorophenoxy)furan-2-carbonyl]amino]benzoate (PubChem CID 2814404) has the molecular formula C19H13Cl2NO5 and a molecular weight of 406.22 g/mol. Its IUPAC name is methyl 2-[[5-(3,5-dichlorophenoxy)furan-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(3,5-dichlorophenoxy)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2814404 |
| Molecular Formula | C19H13Cl2NO5 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | methyl 2-[[5-(3,5-dichlorophenoxy)furan-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(Oc2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C19H13Cl2NO5/c1-25-19(24)14-4-2-3-5-15(14)22-18(23)16-6-7-17(27-16)26-13-9-11(20)8-12(21)10-13/h2-10H,1H3,(H,22,23) |
| InChIKey | NRUANCRRUFJXIG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |