C17H12Cl2N2O2 — CID 100829850
N-(4-aminophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 100829850) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is N-(4-aminophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 100829850 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(4-aminophenyl)-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C17H12Cl2N2O2/c18-13-3-1-2-12(16(13)19)14-8-9-15(23-14)17(22)21-11-6-4-10(20)5-7-11/h1-9H,20H2,(H,21,22) |
| InChIKey | XLIMAUZUXMCVTL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|