C19H11Cl4NO2 — CID 3673672
N-(2,5-dichlorophenyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3673672) has the molecular formula C19H11Cl4NO2 and a molecular weight of 427.11 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3673672 |
| Molecular Formula | C19H11Cl4NO2 |
| Molecular Weight | 427.11 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H11Cl4NO2/c20-11-4-7-14(21)16(10-11)24-18(25)9-6-12-5-8-17(26-12)13-2-1-3-15(22)19(13)23/h1-10H,(H,24,25) |
| InChIKey | SZDLQQRCIFKGOU-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.11 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|