C22H13Cl3N2O2S — CID 3510241
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3510241) has the molecular formula C22H13Cl3N2O2S and a molecular weight of 475.78 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3510241 |
| Molecular Formula | C22H13Cl3N2O2S |
| Molecular Weight | 475.78 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C22H13Cl3N2O2S/c23-14-6-4-13(5-7-14)18-12-30-22(26-18)27-20(28)11-9-15-8-10-19(29-15)16-2-1-3-17(24)21(16)25/h1-12H,(H,26,27,28) |
| InChIKey | VCPMLMXRVWGSEC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.78 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|