C23H14BrCl2N3O2S2 — CID 3364759
N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3364759) has the molecular formula C23H14BrCl2N3O2S2 and a molecular weight of 579.33 g/mol. Its IUPAC name is N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3364759 |
| Molecular Formula | C23H14BrCl2N3O2S2 |
| Molecular Weight | 579.33 g/mol |
| Exact Mass | 576.91 |
| IUPAC Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C23H14BrCl2N3O2S2/c24-14-6-4-13(5-7-14)18-12-33-23(27-18)29-22(32)28-20(30)11-9-15-8-10-19(31-15)16-2-1-3-17(25)21(16)26/h1-12H,(H2,27,28,29,30,32) |
| InChIKey | FSIJFSAAIYAKHF-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.33 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|