C27H18ClN3O2S2 — CID 4288776
3-[5-(4-chlorophenyl)furan-2-yl]-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 4288776) has the molecular formula C27H18ClN3O2S2 and a molecular weight of 516.05 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4288776 |
| Molecular Formula | C27H18ClN3O2S2 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C27H18ClN3O2S2/c28-21-9-7-18(8-10-21)24-13-11-22(33-24)12-14-25(32)30-26(34)31-27-29-23(16-35-27)20-6-5-17-3-1-2-4-19(17)15-20/h1-16H,(H2,29,30,31,32,34) |
| InChIKey | ZBLJNUKIONCLEJ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|