C22H14ClN3O4S — CID 3909497
3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3909497) has the molecular formula C22H14ClN3O4S and a molecular weight of 451.89 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3909497 |
| Molecular Formula | C22H14ClN3O4S |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C22H14ClN3O4S/c23-16-6-4-14(5-7-16)20-10-8-18(30-20)9-11-21(27)25-22-24-19(13-31-22)15-2-1-3-17(12-15)26(28)29/h1-13H,(H,24,25,27) |
| InChIKey | WBIVPIYJPLOXQI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|