C25H19Cl2N3O4S2 — CID 17315773
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide (PubChem CID 17315773) has the molecular formula C25H19Cl2N3O4S2 and a molecular weight of 560.48 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17315773 |
| Molecular Formula | C25H19Cl2N3O4S2 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.02 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)/C=C/c3ccc(-c4cc(Cl)cc(Cl)c4)o3)n2)cc1OC |
| InChI | InChI=1S/C25H19Cl2N3O4S2/c1-32-21-6-3-14(11-22(21)33-2)19-13-36-25(28-19)30-24(35)29-23(31)8-5-18-4-7-20(34-18)15-9-16(26)12-17(27)10-15/h3-13H,1-2H3,(H2,28,29,30,31,35)/b8-5+ |
| InChIKey | BHVNBUTVYJFRFW-VMPITWQZSA-N |
| XLogP | 6.92 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|