C21H15Cl2N3O5S — CID 17114368
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]prop-2-enamide (PubChem CID 17114368) has the molecular formula C21H15Cl2N3O5S and a molecular weight of 492.34 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17114368 |
| Molecular Formula | C21H15Cl2N3O5S |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(=O)/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1 |
| InChI | InChI=1S/C21H15Cl2N3O5S/c1-30-19-5-2-15(26(28)29)11-17(19)24-21(32)25-20(27)7-4-16-3-6-18(31-16)12-8-13(22)10-14(23)9-12/h2-11H,1H3,(H2,24,25,27,32)/b7-4+ |
| InChIKey | SNKBIKRCRWYZKZ-QPJJXVBHSA-N |
| XLogP | 5.70 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|