C20H14Cl2N2O2S2 — CID 17103938
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-sulfanylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 17103938) has the molecular formula C20H14Cl2N2O2S2 and a molecular weight of 449.38 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-sulfanylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-sulfanylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17103938 |
| Molecular Formula | C20H14Cl2N2O2S2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-sulfanylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccccc1S |
| InChI | InChI=1S/C20H14Cl2N2O2S2/c21-13-9-12(10-14(22)11-13)17-7-5-15(26-17)6-8-19(25)24-20(28)23-16-3-1-2-4-18(16)27/h1-11,27H,(H2,23,24,25,28)/b8-6+ |
| InChIKey | LEVIEOSXKBPZDU-SOFGYWHQSA-N |
| XLogP | 6.07 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|