C24H22Cl2N2O3S — CID 17114338
(E)-N-[(5-butan-2-yl-2-hydroxyphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17114338) has the molecular formula C24H22Cl2N2O3S and a molecular weight of 489.42 g/mol. Its IUPAC name is (E)-N-[(5-butan-2-yl-2-hydroxyphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(5-butan-2-yl-2-hydroxyphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17114338 |
| Molecular Formula | C24H22Cl2N2O3S |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (E)-N-[(5-butan-2-yl-2-hydroxyphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCC(C)c1ccc(O)c(NC(=S)NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C24H22Cl2N2O3S/c1-3-14(2)15-4-7-21(29)20(12-15)27-24(32)28-23(30)9-6-19-5-8-22(31-19)16-10-17(25)13-18(26)11-16/h4-14,29H,3H2,1-2H3,(H2,27,28,30,32)/b9-6+ |
| InChIKey | VSQJYLYJWUTGBT-RMKNXTFCSA-N |
| XLogP | 7.00 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|