C24H20Cl3N3O3S — CID 17315781
(E)-N-[(5-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17315781) has the molecular formula C24H20Cl3N3O3S and a molecular weight of 536.87 g/mol. Its IUPAC name is (E)-N-[(5-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(5-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17315781 |
| Molecular Formula | C24H20Cl3N3O3S |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | (E)-N-[(5-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H20Cl3N3O3S/c25-16-1-4-21(30-7-9-32-10-8-30)20(14-16)28-24(34)29-23(31)6-3-19-2-5-22(33-19)15-11-17(26)13-18(27)12-15/h1-6,11-14H,7-10H2,(H2,28,29,31,34)/b6-3+ |
| InChIKey | AUWHEFKHBVYHPF-ZZXKWVIFSA-N |
| XLogP | 6.27 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|