C23H21Cl2N3O3 — CID 28689032
(E)-N-(3-amino-4-morpholin-4-ylphenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 28689032) has the molecular formula C23H21Cl2N3O3 and a molecular weight of 458.35 g/mol. Its IUPAC name is (E)-N-(3-amino-4-morpholin-4-ylphenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(3-amino-4-morpholin-4-ylphenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 28689032 |
| Molecular Formula | C23H21Cl2N3O3 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | (E)-N-(3-amino-4-morpholin-4-ylphenyl)-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Nc1cc(NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H21Cl2N3O3/c24-16-11-15(12-17(25)13-16)22-5-2-19(31-22)3-6-23(29)27-18-1-4-21(20(26)14-18)28-7-9-30-10-8-28/h1-6,11-14H,7-10,26H2,(H,27,29)/b6-3+ |
| InChIKey | CFMYOTYOPSGYSJ-ZZXKWVIFSA-N |
| XLogP | 5.32 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|