C24H21Cl2N3O3S — CID 3349871
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-morpholin-4-ylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 3349871) has the molecular formula C24H21Cl2N3O3S and a molecular weight of 502.42 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-morpholin-4-ylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-morpholin-4-ylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3349871 |
| Molecular Formula | C24H21Cl2N3O3S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-morpholin-4-ylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C24H21Cl2N3O3S/c25-18-5-3-4-17(23(18)26)21-10-8-16(32-21)9-11-22(30)28-24(33)27-19-6-1-2-7-20(19)29-12-14-31-15-13-29/h1-11H,12-15H2,(H2,27,28,30,33) |
| InChIKey | YYFDNNQWOVAMFZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|