C19H13Cl2N3O5S — CID 17103821
5-(3,4-dichlorophenyl)-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 17103821) has the molecular formula C19H13Cl2N3O5S and a molecular weight of 466.30 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17103821 |
| Molecular Formula | C19H13Cl2N3O5S |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-[(2-methoxy-5-nitrophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H13Cl2N3O5S/c1-28-16-5-3-11(24(26)27)9-14(16)22-19(30)23-18(25)17-7-6-15(29-17)10-2-4-12(20)13(21)8-10/h2-9H,1H3,(H2,22,23,25,30) |
| InChIKey | MOYUWCVKLGPFNY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|