C16H9Cl2N5O4S — CID 11495843
N-[(4,6-dichloropyrimidin-2-yl)carbamothioyl]-5-(4-nitrophenyl)furan-2-carboxamide (PubChem CID 11495843) has the molecular formula C16H9Cl2N5O4S and a molecular weight of 438.25 g/mol. Its IUPAC name is N-[(4,6-dichloropyrimidin-2-yl)carbamothioyl]-5-(4-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[(4,6-dichloropyrimidin-2-yl)carbamothioyl]-5-(4-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11495843 |
| Molecular Formula | C16H9Cl2N5O4S |
| Molecular Weight | 438.25 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | N-[(4,6-dichloropyrimidin-2-yl)carbamothioyl]-5-(4-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1nc(Cl)cc(Cl)n1)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H9Cl2N5O4S/c17-12-7-13(18)20-15(19-12)22-16(28)21-14(24)11-6-5-10(27-11)8-1-3-9(4-2-8)23(25)26/h1-7H,(H2,19,20,21,22,24,28) |
| InChIKey | HGZUYHXMZAQXGS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|